C32H35N9O6S2 — CID 175210134
2-[[6-[4-[6-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfanylhexanoyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 175210134) has the molecular formula C32H35N9O6S2 and a molecular weight of 705.82 g/mol. Its IUPAC name is 2-[[6-[4-[6-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfanylhexanoyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[[6-[4-[6-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfanylhexanoyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 175210134 |
| Molecular Formula | C32H35N9O6S2 |
| Molecular Weight | 705.82 g/mol |
| Exact Mass | 705.22 |
| IUPAC Name | 2-[[6-[4-[6-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfanylhexanoyl]piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(Nc2ncc(C(N)=O)s2)cc(N2CCN(C(=O)CCCCCSc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)CC2)n1 |
| InChI | InChI=1S/C32H35N9O6S2/c1-18-35-23(37-32-34-17-22(49-32)28(33)44)16-24(36-18)39-11-13-40(14-12-39)26(43)8-3-2-4-15-48-21-7-5-6-19-27(21)31(47)41(30(19)46)20-9-10-25(42)38-29(20)45/h5-7,16-17,20H,2-4,8-15H2,1H3,(H2,33,44)(H,38,42,45)(H,34,35,36,37) |
| InChIKey | DQVDXRYXGNCEIP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 200.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.82 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|