C11H10ClN5O — CID 175213252
N-[[4-(3-chloroanilino)pyrimidin-5-yl]amino]formamide (PubChem CID 175213252) has the molecular formula C11H10ClN5O and a molecular weight of 263.69 g/mol. Its IUPAC name is N-[[4-(3-chloroanilino)pyrimidin-5-yl]amino]formamide.
| Compound Name | N-[[4-(3-chloroanilino)pyrimidin-5-yl]amino]formamide |
|---|---|
| PubChem CID | 175213252 |
| Molecular Formula | C11H10ClN5O |
| Molecular Weight | 263.69 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | N-[[4-(3-chloroanilino)pyrimidin-5-yl]amino]formamide |
| SMILES | O=CNNc1cncnc1Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H10ClN5O/c12-8-2-1-3-9(4-8)16-11-10(17-15-7-18)5-13-6-14-11/h1-7,17H,(H,15,18)(H,13,14,16) |
| InChIKey | CXQVHGJOEOEXMM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.69 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|