C15H21F2NO2S — CID 175214625
tert-butyl-[1-[3-(difluoromethoxy)phenyl]but-3-enylamino]-oxidosulfanium (PubChem CID 175214625) has the molecular formula C15H21F2NO2S and a molecular weight of 317.40 g/mol. Its IUPAC name is tert-butyl-[1-[3-(difluoromethoxy)phenyl]but-3-enylamino]-oxidosulfanium.
| Compound Name | tert-butyl-[1-[3-(difluoromethoxy)phenyl]but-3-enylamino]-oxidosulfanium |
|---|---|
| PubChem CID | 175214625 |
| Molecular Formula | C15H21F2NO2S |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | tert-butyl-[1-[3-(difluoromethoxy)phenyl]but-3-enylamino]-oxidosulfanium |
| SMILES | C=CCC(N[S+]([O-])C(C)(C)C)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C15H21F2NO2S/c1-5-7-13(18-21(19)15(2,3)4)11-8-6-9-12(10-11)20-14(16)17/h5-6,8-10,13-14,18H,1,7H2,2-4H3 |
| InChIKey | MIETZDJMVMIPQX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 44.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|