C14H20O7 — CID 175215462
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[1-(3-hydroxyphenyl)ethoxy]oxane-3,4,5-triol (PubChem CID 175215462) has the molecular formula C14H20O7 and a molecular weight of 300.31 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[1-(3-hydroxyphenyl)ethoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[1-(3-hydroxyphenyl)ethoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 175215462 |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[1-(3-hydroxyphenyl)ethoxy]oxane-3,4,5-triol |
| SMILES | CC(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)c1cccc(O)c1 |
| InChI | InChI=1S/C14H20O7/c1-7(8-3-2-4-9(16)5-8)20-14-13(19)12(18)11(17)10(6-15)21-14/h2-5,7,10-19H,6H2,1H3/t7?,10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | CEJMBXZSOKFMAD-DELNEQSJSA-N |
| XLogP | -0.73 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |