About [(1,4-dimethylbenzotriazol-5-yl)-[3-(hydroxymethyl)-4-methylphenyl]methyl] cyclobutanecarboxylate
[(1,4-dimethylbenzotriazol-5-yl)-[3-(hydroxymethyl)-4-methylphenyl]methyl] cyclobutanecarboxylate (PubChem CID 175216668) has the molecular formula C22H25N3O3
and a molecular weight of 379.46 g/mol. Its IUPAC name is [(1,4-dimethylbenzotriazol-5-yl)-[3-(hydroxymethyl)-4-methylphenyl]methyl] cyclobutanecarboxylate.
Molecular Properties
| Compound Name | [(1,4-dimethylbenzotriazol-5-yl)-[3-(hydroxymethyl)-4-methylphenyl]methyl] cyclobutanecarboxylate |
| PubChem CID | 175216668 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | [(1,4-dimethylbenzotriazol-5-yl)-[3-(hydroxymethyl)-4-methylphenyl]methyl] cyclobutanecarboxylate |
| SMILES | Cc1ccc(C(OC(=O)C2CCC2)c2ccc3c(nnn3C)c2C)cc1CO |
| InChI | InChI=1S/C22H25N3O3/c1-13-7-8-16(11-17(13)12-26)21(28-22(27)15-5-4-6-15)18-9-10-19-20(14(18)2)23-24-25(19)3/h7-11,15,21,26H,4-6,12H2,1-3H3 |
| InChIKey | KBBGWFJCFRIOAJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(1,4-dimethylbenzotriazol-5-yl)-[3-(hydroxymethyl)-4-methylphenyl]methyl] cyclobutanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1,4-dimethylbenzotriazol-5-yl)-[3-(hydroxymethyl)-4-methylphenyl]methyl] cyclobutanecarboxylate?
The IUPAC name of [(1,4-dimethylbenzotriazol-5-yl)-[3-(hydroxymethyl)-4-methylphenyl]methyl] cyclobutanecarboxylate (CID 175216668) is [(1,4-dimethylbenzotriazol-5-yl)-[3-(hydroxymethyl)-4-methylphenyl]methyl] cyclobutanecarboxylate.
What is the SMILES notation for [(1,4-dimethylbenzotriazol-5-yl)-[3-(hydroxymethyl)-4-methylphenyl]methyl] cyclobutanecarboxylate?
The canonical SMILES for [(1,4-dimethylbenzotriazol-5-yl)-[3-(hydroxymethyl)-4-methylphenyl]methyl] cyclobutanecarboxylate is Cc1ccc(C(OC(=O)C2CCC2)c2ccc3c(nnn3C)c2C)cc1CO.
What is the InChIKey of [(1,4-dimethylbenzotriazol-5-yl)-[3-(hydroxymethyl)-4-methylphenyl]methyl] cyclobutanecarboxylate?
The InChIKey is KBBGWFJCFRIOAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O3/c1-13-7-8-16(11-17(13)12-26)21(28-22(27)15-5-4-6-15)18-9-10-19-20(14(18)2)23-24-25(19)3/h7-11,15,21,26H,4-6,12H2,1-3H3.
What are the key properties of [(1,4-dimethylbenzotriazol-5-yl)-[3-(hydroxymethyl)-4-methylphenyl]methyl] cyclobutanecarboxylate?
[(1,4-dimethylbenzotriazol-5-yl)-[3-(hydroxymethyl)-4-methylphenyl]methyl] cyclobutanecarboxylate has a molecular weight of 379.46 g/mol, XLogP of 3.51, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1,4-dimethylbenzotriazol-5-yl)-[3-(hydroxymethyl)-4-methylphenyl]methyl] cyclobutanecarboxylate is sourced from PubChem (CID 175216668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).