About 3-(1-oct-1-enoxypentyl)undeca-1,4-dien-1-amine
3-(1-oct-1-enoxypentyl)undeca-1,4-dien-1-amine (PubChem CID 175220578) has the molecular formula C24H45NO
and a molecular weight of 363.63 g/mol. Its IUPAC name is 3-(1-oct-1-enoxypentyl)undeca-1,4-dien-1-amine.
Molecular Properties
| Compound Name | 3-(1-oct-1-enoxypentyl)undeca-1,4-dien-1-amine |
| PubChem CID | 175220578 |
| Molecular Formula | C24H45NO |
| Molecular Weight | 363.63 g/mol |
| Exact Mass | 363.35 |
| IUPAC Name | 3-(1-oct-1-enoxypentyl)undeca-1,4-dien-1-amine |
| SMILES | CCCCCCC=COC(CCCC)C(C=CN)C=CCCCCCC |
| InChI | InChI=1S/C24H45NO/c1-4-7-10-12-14-16-18-23(20-21-25)24(19-9-6-3)26-22-17-15-13-11-8-5-2/h16-18,20-24H,4-15,19,25H2,1-3H3 |
| InChIKey | BHLKCRNTWSHZLQ-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.63 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-oct-1-enoxypentyl)undeca-1,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-oct-1-enoxypentyl)undeca-1,4-dien-1-amine?
The IUPAC name of 3-(1-oct-1-enoxypentyl)undeca-1,4-dien-1-amine (CID 175220578) is 3-(1-oct-1-enoxypentyl)undeca-1,4-dien-1-amine.
What is the SMILES notation for 3-(1-oct-1-enoxypentyl)undeca-1,4-dien-1-amine?
The canonical SMILES for 3-(1-oct-1-enoxypentyl)undeca-1,4-dien-1-amine is CCCCCCC=COC(CCCC)C(C=CN)C=CCCCCCC.
What is the InChIKey of 3-(1-oct-1-enoxypentyl)undeca-1,4-dien-1-amine?
The InChIKey is BHLKCRNTWSHZLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H45NO/c1-4-7-10-12-14-16-18-23(20-21-25)24(19-9-6-3)26-22-17-15-13-11-8-5-2/h16-18,20-24H,4-15,19,25H2,1-3H3.
What are the key properties of 3-(1-oct-1-enoxypentyl)undeca-1,4-dien-1-amine?
3-(1-oct-1-enoxypentyl)undeca-1,4-dien-1-amine has a molecular weight of 363.63 g/mol, XLogP of 7.66, 18 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-oct-1-enoxypentyl)undeca-1,4-dien-1-amine is sourced from PubChem (CID 175220578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).