C23H18O4 — CID 175221703
7-oxabicyclo[2.2.1]hepta-1,3,5-triene;[2-(3-oxo-3-phenylprop-1-enyl)phenyl] acetate (PubChem CID 175221703) has the molecular formula C23H18O4 and a molecular weight of 358.39 g/mol. Its IUPAC name is 7-oxabicyclo[2.2.1]hepta-1,3,5-triene;[2-(3-oxo-3-phenylprop-1-enyl)phenyl] acetate.
| Compound Name | 7-oxabicyclo[2.2.1]hepta-1,3,5-triene;[2-(3-oxo-3-phenylprop-1-enyl)phenyl] acetate |
|---|---|
| PubChem CID | 175221703 |
| Molecular Formula | C23H18O4 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 7-oxabicyclo[2.2.1]hepta-1,3,5-triene;[2-(3-oxo-3-phenylprop-1-enyl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C=CC(=O)c1ccccc1.c1cc2ccc1o2 |
| InChI | InChI=1S/C17H14O3.C6H4O/c1-13(18)20-17-10-6-5-9-15(17)11-12-16(19)14-7-3-2-4-8-14;1-2-6-4-3-5(1)7-6/h2-12H,1H3;1-4H |
| InChIKey | AHTNAVDIBPLTGU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|