About potassium;ethylcyclohexane;propanedioic acid
potassium;ethylcyclohexane;propanedioic acid (PubChem CID 175224947) has the molecular formula C11H19KO4
and a molecular weight of 254.37 g/mol. Its IUPAC name is potassium;ethylcyclohexane;propanedioic acid.
Molecular Properties
| Compound Name | potassium;ethylcyclohexane;propanedioic acid |
| PubChem CID | 175224947 |
| Molecular Formula | C11H19KO4 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | potassium;ethylcyclohexane;propanedioic acid |
| SMILES | O=C(O)CC(=O)O.[CH2-]CC1CCCCC1.[K+] |
| InChI | InChI=1S/C8H15.C3H4O4.K/c1-2-8-6-4-3-5-7-8;4-2(5)1-3(6)7;/h8H,1-7H2;1H2,(H,4,5)(H,6,7);/q-1;;+1 |
| InChIKey | VRZHVARCFZNPCH-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium;ethylcyclohexane;propanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;ethylcyclohexane;propanedioic acid?
The IUPAC name of potassium;ethylcyclohexane;propanedioic acid (CID 175224947) is potassium;ethylcyclohexane;propanedioic acid.
What is the SMILES notation for potassium;ethylcyclohexane;propanedioic acid?
The canonical SMILES for potassium;ethylcyclohexane;propanedioic acid is O=C(O)CC(=O)O.[CH2-]CC1CCCCC1.[K+].
What is the InChIKey of potassium;ethylcyclohexane;propanedioic acid?
The InChIKey is VRZHVARCFZNPCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15.C3H4O4.K/c1-2-8-6-4-3-5-7-8;4-2(5)1-3(6)7;/h8H,1-7H2;1H2,(H,4,5)(H,6,7);/q-1;;+1.
What are the key properties of potassium;ethylcyclohexane;propanedioic acid?
potassium;ethylcyclohexane;propanedioic acid has a molecular weight of 254.37 g/mol, XLogP of -0.66, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;ethylcyclohexane;propanedioic acid is sourced from PubChem (CID 175224947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).