C30H24ClN3O7S — CID 175227172
2-[[10-(1-benzofuran-6-carbonyl)-6-chloro-1,10-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-5-carbonyl]amino]-3-(3-methylsulfonylphenyl)propanoic acid (PubChem CID 175227172) has the molecular formula C30H24ClN3O7S and a molecular weight of 606.06 g/mol. Its IUPAC name is 2-[[10-(1-benzofuran-6-carbonyl)-6-chloro-1,10-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-5-carbonyl]amino]-3-(3-methylsulfonylphenyl)propanoic acid.
| Compound Name | 2-[[10-(1-benzofuran-6-carbonyl)-6-chloro-1,10-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-5-carbonyl]amino]-3-(3-methylsulfonylphenyl)propanoic acid |
|---|---|
| PubChem CID | 175227172 |
| Molecular Formula | C30H24ClN3O7S |
| Molecular Weight | 606.06 g/mol |
| Exact Mass | 605.10 |
| IUPAC Name | 2-[[10-(1-benzofuran-6-carbonyl)-6-chloro-1,10-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-5-carbonyl]amino]-3-(3-methylsulfonylphenyl)propanoic acid |
| SMILES | CS(=O)(=O)c1cccc(CC(NC(=O)c2c(Cl)cc3c4c2ccn4CN(C(=O)c2ccc4ccoc4c2)C3)C(=O)O)c1 |
| InChI | InChI=1S/C30H24ClN3O7S/c1-42(39,40)21-4-2-3-17(11-21)12-24(30(37)38)32-28(35)26-22-7-9-33-16-34(15-20(27(22)33)13-23(26)31)29(36)19-6-5-18-8-10-41-25(18)14-19/h2-11,13-14,24H,12,15-16H2,1H3,(H,32,35)(H,37,38) |
| InChIKey | OIJQWWVUGBYOPL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 138.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.06 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |