C15H20F3N3O — CID 175229917
3-amino-N-[2-(3-methylpyrrolidin-1-yl)ethyl]-5-(trifluoromethyl)benzamide (PubChem CID 175229917) has the molecular formula C15H20F3N3O and a molecular weight of 315.34 g/mol. Its IUPAC name is 3-amino-N-[2-(3-methylpyrrolidin-1-yl)ethyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 3-amino-N-[2-(3-methylpyrrolidin-1-yl)ethyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 175229917 |
| Molecular Formula | C15H20F3N3O |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 3-amino-N-[2-(3-methylpyrrolidin-1-yl)ethyl]-5-(trifluoromethyl)benzamide |
| SMILES | CC1CCN(CCNC(=O)c2cc(N)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C15H20F3N3O/c1-10-2-4-21(9-10)5-3-20-14(22)11-6-12(15(16,17)18)8-13(19)7-11/h6-8,10H,2-5,9,19H2,1H3,(H,20,22) |
| InChIKey | UQDNNQZTYMFYIR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|