About (3-sulfamoylphenyl) cyclopropanecarboxylate
(3-sulfamoylphenyl) cyclopropanecarboxylate (PubChem CID 175230114) has the molecular formula C10H11NO4S
and a molecular weight of 241.27 g/mol. Its IUPAC name is (3-sulfamoylphenyl) cyclopropanecarboxylate.
Molecular Properties
| Compound Name | (3-sulfamoylphenyl) cyclopropanecarboxylate |
| PubChem CID | 175230114 |
| Molecular Formula | C10H11NO4S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | (3-sulfamoylphenyl) cyclopropanecarboxylate |
| SMILES | NS(=O)(=O)c1cccc(OC(=O)C2CC2)c1 |
| InChI | InChI=1S/C10H11NO4S/c11-16(13,14)9-3-1-2-8(6-9)15-10(12)7-4-5-7/h1-3,6-7H,4-5H2,(H2,11,13,14) |
| InChIKey | VYYPLZQGHLAXRQ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-sulfamoylphenyl) cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-sulfamoylphenyl) cyclopropanecarboxylate?
The IUPAC name of (3-sulfamoylphenyl) cyclopropanecarboxylate (CID 175230114) is (3-sulfamoylphenyl) cyclopropanecarboxylate.
What is the SMILES notation for (3-sulfamoylphenyl) cyclopropanecarboxylate?
The canonical SMILES for (3-sulfamoylphenyl) cyclopropanecarboxylate is NS(=O)(=O)c1cccc(OC(=O)C2CC2)c1.
What is the InChIKey of (3-sulfamoylphenyl) cyclopropanecarboxylate?
The InChIKey is VYYPLZQGHLAXRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO4S/c11-16(13,14)9-3-1-2-8(6-9)15-10(12)7-4-5-7/h1-3,6-7H,4-5H2,(H2,11,13,14).
What are the key properties of (3-sulfamoylphenyl) cyclopropanecarboxylate?
(3-sulfamoylphenyl) cyclopropanecarboxylate has a molecular weight of 241.27 g/mol, XLogP of 0.65, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-sulfamoylphenyl) cyclopropanecarboxylate is sourced from PubChem (CID 175230114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).