C20H22N4O4 — CID 175230513
6-(4-methoxyphenyl)-1-(2-morpholin-4-yl-2-oxoethyl)-2,3-dihydroimidazo[4,5-b]pyridine-2-carbaldehyde (PubChem CID 175230513) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-1-(2-morpholin-4-yl-2-oxoethyl)-2,3-dihydroimidazo[4,5-b]pyridine-2-carbaldehyde.
| Compound Name | 6-(4-methoxyphenyl)-1-(2-morpholin-4-yl-2-oxoethyl)-2,3-dihydroimidazo[4,5-b]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 175230513 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 6-(4-methoxyphenyl)-1-(2-morpholin-4-yl-2-oxoethyl)-2,3-dihydroimidazo[4,5-b]pyridine-2-carbaldehyde |
| SMILES | COc1ccc(-c2cnc3c(c2)N(CC(=O)N2CCOCC2)C(C=O)N3)cc1 |
| InChI | InChI=1S/C20H22N4O4/c1-27-16-4-2-14(3-5-16)15-10-17-20(21-11-15)22-18(13-25)24(17)12-19(26)23-6-8-28-9-7-23/h2-5,10-11,13,18H,6-9,12H2,1H3,(H,21,22) |
| InChIKey | RIRJYIJTLVKHJW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|