C17H18N2O2S — CID 175230517
N'-(benzenecarbonothioyl)-3-(4-hydroxyphenyl)-2-methylpropanehydrazide (PubChem CID 175230517) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is N'-(benzenecarbonothioyl)-3-(4-hydroxyphenyl)-2-methylpropanehydrazide.
| Compound Name | N'-(benzenecarbonothioyl)-3-(4-hydroxyphenyl)-2-methylpropanehydrazide |
|---|---|
| PubChem CID | 175230517 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N'-(benzenecarbonothioyl)-3-(4-hydroxyphenyl)-2-methylpropanehydrazide |
| SMILES | CC(Cc1ccc(O)cc1)C(=O)NNC(=S)c1ccccc1 |
| InChI | InChI=1S/C17H18N2O2S/c1-12(11-13-7-9-15(20)10-8-13)16(21)18-19-17(22)14-5-3-2-4-6-14/h2-10,12,20H,11H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | OXHKQTGUILZMBP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|