C21H16BrN5O3S — CID 175232206
(2S)-2-[[3-(2-bromo-3-phenylanilino)-[1,2]thiazolo[4,5-b]pyrazin-6-yl]methylideneamino]-3-hydroxypropanoic acid (PubChem CID 175232206) has the molecular formula C21H16BrN5O3S and a molecular weight of 498.36 g/mol. Its IUPAC name is (2S)-2-[[3-(2-bromo-3-phenylanilino)-[1,2]thiazolo[4,5-b]pyrazin-6-yl]methylideneamino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[[3-(2-bromo-3-phenylanilino)-[1,2]thiazolo[4,5-b]pyrazin-6-yl]methylideneamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 175232206 |
| Molecular Formula | C21H16BrN5O3S |
| Molecular Weight | 498.36 g/mol |
| Exact Mass | 497.02 |
| IUPAC Name | (2S)-2-[[3-(2-bromo-3-phenylanilino)-[1,2]thiazolo[4,5-b]pyrazin-6-yl]methylideneamino]-3-hydroxypropanoic acid |
| SMILES | O=C(O)[C@H](CO)/N=C/c1cnc2c(Nc3cccc(-c4ccccc4)c3Br)nsc2n1 |
| InChI | InChI=1S/C21H16BrN5O3S/c22-17-14(12-5-2-1-3-6-12)7-4-8-15(17)26-19-18-20(31-27-19)25-13(10-24-18)9-23-16(11-28)21(29)30/h1-10,16,28H,11H2,(H,26,27)(H,29,30)/b23-9+/t16-/m0/s1 |
| InChIKey | DASDJNODQGIGHA-ZLAIJAOWSA-N |
| XLogP | 4.12 |
| TPSA | 120.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|