C7H8BrFO — CID 175233982
5-bromo-6-fluoro-5-methoxycyclohexa-1,3-diene (PubChem CID 175233982) has the molecular formula C7H8BrFO and a molecular weight of 207.04 g/mol. Its IUPAC name is 5-bromo-6-fluoro-5-methoxycyclohexa-1,3-diene.
| Compound Name | 5-bromo-6-fluoro-5-methoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 175233982 |
| Molecular Formula | C7H8BrFO |
| Molecular Weight | 207.04 g/mol |
| Exact Mass | 205.97 |
| IUPAC Name | 5-bromo-6-fluoro-5-methoxycyclohexa-1,3-diene |
| SMILES | COC1(Br)C=CC=CC1F |
| InChI | InChI=1S/C7H8BrFO/c1-10-7(8)5-3-2-4-6(7)9/h2-6H,1H3 |
| InChIKey | QCIIURVTDITMFR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.04 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|