C7H8F2O — CID 66729669
1,6-difluoro-6-methoxycyclohexa-1,3-diene (PubChem CID 66729669) has the molecular formula C7H8F2O and a molecular weight of 146.14 g/mol. Its IUPAC name is 1,6-difluoro-6-methoxycyclohexa-1,3-diene.
| Compound Name | 1,6-difluoro-6-methoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 66729669 |
| Molecular Formula | C7H8F2O |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | 1,6-difluoro-6-methoxycyclohexa-1,3-diene |
| SMILES | COC1(F)CC=CC=C1F |
| InChI | InChI=1S/C7H8F2O/c1-10-7(9)5-3-2-4-6(7)8/h2-4H,5H2,1H3 |
| InChIKey | ZRIJZEPPMYWYLY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |