C26H29FN4OS — CID 175236985
N-[5-(4-cyclohexylpiperazin-1-yl)-4-(4-fluorophenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 175236985) has the molecular formula C26H29FN4OS and a molecular weight of 464.61 g/mol. Its IUPAC name is N-[5-(4-cyclohexylpiperazin-1-yl)-4-(4-fluorophenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | N-[5-(4-cyclohexylpiperazin-1-yl)-4-(4-fluorophenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 175236985 |
| Molecular Formula | C26H29FN4OS |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | N-[5-(4-cyclohexylpiperazin-1-yl)-4-(4-fluorophenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nc(-c2ccc(F)cc2)c(N2CCN(C3CCCCC3)CC2)s1)c1ccccc1 |
| InChI | InChI=1S/C26H29FN4OS/c27-21-13-11-19(12-14-21)23-25(31-17-15-30(16-18-31)22-9-5-2-6-10-22)33-26(28-23)29-24(32)20-7-3-1-4-8-20/h1,3-4,7-8,11-14,22H,2,5-6,9-10,15-18H2,(H,28,29,32) |
| InChIKey | ZZERQTFLQLHJFN-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |