C33H29N3 — CID 175237081
cinnoline;methane;4-phenyl-7,8-dihydro-6H-chrysen-5-imine (PubChem CID 175237081) has the molecular formula C33H29N3 and a molecular weight of 467.62 g/mol. Its IUPAC name is cinnoline;methane;4-phenyl-7,8-dihydro-6H-chrysen-5-imine.
| Compound Name | cinnoline;methane;4-phenyl-7,8-dihydro-6H-chrysen-5-imine |
|---|---|
| PubChem CID | 175237081 |
| Molecular Formula | C33H29N3 |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | cinnoline;methane;4-phenyl-7,8-dihydro-6H-chrysen-5-imine |
| SMILES | C.[H]/N=C1\CC2=C(C=CCC2)c2ccc3cccc(-c4ccccc4)c3c21.c1ccc2nnccc2c1 |
| InChI | InChI=1S/C24H19N.C8H6N2.CH4/c25-22-15-18-9-4-5-11-19(18)21-14-13-17-10-6-12-20(23(17)24(21)22)16-7-2-1-3-8-16;1-2-4-8-7(3-1)5-6-9-10-8;/h1-3,5-8,10-14,25H,4,9,15H2;1-6H;1H4/b25-22+;; |
| InChIKey | SIHLITUKSZHQHV-RAUWIDEGSA-N |
| XLogP | 8.65 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|