About cinnoline;hydroiodide
cinnoline;hydroiodide (PubChem CID 174664707) has the molecular formula C8H7IN2
and a molecular weight of 258.06 g/mol. Its IUPAC name is cinnoline;hydroiodide.
Molecular Properties
| Compound Name | cinnoline;hydroiodide |
| PubChem CID | 174664707 |
| Molecular Formula | C8H7IN2 |
| Molecular Weight | 258.06 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | cinnoline;hydroiodide |
| SMILES | I.c1ccc2nnccc2c1 |
| InChI | InChI=1S/C8H6N2.HI/c1-2-4-8-7(3-1)5-6-9-10-8;/h1-6H;1H |
| InChIKey | RTHFKILLVARCRF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.06 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze cinnoline;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cinnoline;hydroiodide?
The IUPAC name of cinnoline;hydroiodide (CID 174664707) is cinnoline;hydroiodide.
What is the SMILES notation for cinnoline;hydroiodide?
The canonical SMILES for cinnoline;hydroiodide is I.c1ccc2nnccc2c1.
What is the InChIKey of cinnoline;hydroiodide?
The InChIKey is RTHFKILLVARCRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.HI/c1-2-4-8-7(3-1)5-6-9-10-8;/h1-6H;1H.
What are the key properties of cinnoline;hydroiodide?
cinnoline;hydroiodide has a molecular weight of 258.06 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cinnoline;hydroiodide is sourced from PubChem (CID 174664707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).