About cinnoline;isoquinoline;phthalazine
cinnoline;isoquinoline;phthalazine (PubChem CID 142014837) has the molecular formula C25H19N5
and a molecular weight of 389.46 g/mol. Its IUPAC name is cinnoline;isoquinoline;phthalazine.
Molecular Properties
| Compound Name | cinnoline;isoquinoline;phthalazine |
| PubChem CID | 142014837 |
| Molecular Formula | C25H19N5 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | cinnoline;isoquinoline;phthalazine |
| SMILES | c1ccc2cnccc2c1.c1ccc2cnncc2c1.c1ccc2nnccc2c1 |
| InChI | InChI=1S/C9H7N.2C8H6N2/c1-2-4-9-7-10-6-5-8(9)3-1;1-2-4-8-6-10-9-5-7(8)3-1;1-2-4-8-7(3-1)5-6-9-10-8/h1-7H;2*1-6H |
| InChIKey | XIIMGMHGXPTCQK-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cinnoline;isoquinoline;phthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cinnoline;isoquinoline;phthalazine?
The IUPAC name of cinnoline;isoquinoline;phthalazine (CID 142014837) is cinnoline;isoquinoline;phthalazine.
What is the SMILES notation for cinnoline;isoquinoline;phthalazine?
The canonical SMILES for cinnoline;isoquinoline;phthalazine is c1ccc2cnccc2c1.c1ccc2cnncc2c1.c1ccc2nnccc2c1.
What is the InChIKey of cinnoline;isoquinoline;phthalazine?
The InChIKey is XIIMGMHGXPTCQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.2C8H6N2/c1-2-4-9-7-10-6-5-8(9)3-1;1-2-4-8-6-10-9-5-7(8)3-1;1-2-4-8-7(3-1)5-6-9-10-8/h1-7H;2*1-6H.
What are the key properties of cinnoline;isoquinoline;phthalazine?
cinnoline;isoquinoline;phthalazine has a molecular weight of 389.46 g/mol, XLogP of 5.49, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cinnoline;isoquinoline;phthalazine is sourced from PubChem (CID 142014837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).