About cinnoline;ethoxyethane
cinnoline;ethoxyethane (PubChem CID 122673092) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is cinnoline;ethoxyethane.
Molecular Properties
| Compound Name | cinnoline;ethoxyethane |
| PubChem CID | 122673092 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | cinnoline;ethoxyethane |
| SMILES | CCOCC.c1ccc2nnccc2c1 |
| InChI | InChI=1S/C8H6N2.C4H10O/c1-2-4-8-7(3-1)5-6-9-10-8;1-3-5-4-2/h1-6H;3-4H2,1-2H3 |
| InChIKey | RDSOACKAWYETRV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cinnoline;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cinnoline;ethoxyethane?
The IUPAC name of cinnoline;ethoxyethane (CID 122673092) is cinnoline;ethoxyethane.
What is the SMILES notation for cinnoline;ethoxyethane?
The canonical SMILES for cinnoline;ethoxyethane is CCOCC.c1ccc2nnccc2c1.
What is the InChIKey of cinnoline;ethoxyethane?
The InChIKey is RDSOACKAWYETRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.C4H10O/c1-2-4-8-7(3-1)5-6-9-10-8;1-3-5-4-2/h1-6H;3-4H2,1-2H3.
What are the key properties of cinnoline;ethoxyethane?
cinnoline;ethoxyethane has a molecular weight of 204.27 g/mol, XLogP of 2.67, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cinnoline;ethoxyethane is sourced from PubChem (CID 122673092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).