About benzo[f]cinnoline;ethanol
benzo[f]cinnoline;ethanol (PubChem CID 175086691) has the molecular formula C14H14N2O
and a molecular weight of 226.28 g/mol. Its IUPAC name is benzo[f]cinnoline;ethanol.
Molecular Properties
| Compound Name | benzo[f]cinnoline;ethanol |
| PubChem CID | 175086691 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | benzo[f]cinnoline;ethanol |
| SMILES | CCO.c1ccc2c(c1)ccc1nnccc12 |
| InChI | InChI=1S/C12H8N2.C2H6O/c1-2-4-10-9(3-1)5-6-12-11(10)7-8-13-14-12;1-2-3/h1-8H;3H,2H2,1H3 |
| InChIKey | YIMWIWJMPWLQOT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzo[f]cinnoline;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[f]cinnoline;ethanol?
The IUPAC name of benzo[f]cinnoline;ethanol (CID 175086691) is benzo[f]cinnoline;ethanol.
What is the SMILES notation for benzo[f]cinnoline;ethanol?
The canonical SMILES for benzo[f]cinnoline;ethanol is CCO.c1ccc2c(c1)ccc1nnccc12.
What is the InChIKey of benzo[f]cinnoline;ethanol?
The InChIKey is YIMWIWJMPWLQOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2.C2H6O/c1-2-4-10-9(3-1)5-6-12-11(10)7-8-13-14-12;1-2-3/h1-8H;3H,2H2,1H3.
What are the key properties of benzo[f]cinnoline;ethanol?
benzo[f]cinnoline;ethanol has a molecular weight of 226.28 g/mol, XLogP of 2.78, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[f]cinnoline;ethanol is sourced from PubChem (CID 175086691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).