About cinnoline;phenol
cinnoline;phenol (PubChem CID 174264955) has the molecular formula C14H12N2O
and a molecular weight of 224.26 g/mol. Its IUPAC name is cinnoline;phenol.
Molecular Properties
| Compound Name | cinnoline;phenol |
| PubChem CID | 174264955 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | cinnoline;phenol |
| SMILES | Oc1ccccc1.c1ccc2nnccc2c1 |
| InChI | InChI=1S/C8H6N2.C6H6O/c1-2-4-8-7(3-1)5-6-9-10-8;7-6-4-2-1-3-5-6/h1-6H;1-5,7H |
| InChIKey | JWXSEKRQDUCDHN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cinnoline;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cinnoline;phenol?
The IUPAC name of cinnoline;phenol (CID 174264955) is cinnoline;phenol.
What is the SMILES notation for cinnoline;phenol?
The canonical SMILES for cinnoline;phenol is Oc1ccccc1.c1ccc2nnccc2c1.
What is the InChIKey of cinnoline;phenol?
The InChIKey is JWXSEKRQDUCDHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.C6H6O/c1-2-4-8-7(3-1)5-6-9-10-8;7-6-4-2-1-3-5-6/h1-6H;1-5,7H.
What are the key properties of cinnoline;phenol?
cinnoline;phenol has a molecular weight of 224.26 g/mol, XLogP of 3.02, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cinnoline;phenol is sourced from PubChem (CID 174264955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).