C26H23N3O4 — CID 175237547
3-[3-[(2-amino-3,4-dioxocyclobuten-1-yl)amino]phenyl]-N-(4-methoxyphenyl)-2-phenylpropanamide (PubChem CID 175237547) has the molecular formula C26H23N3O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is 3-[3-[(2-amino-3,4-dioxocyclobuten-1-yl)amino]phenyl]-N-(4-methoxyphenyl)-2-phenylpropanamide.
| Compound Name | 3-[3-[(2-amino-3,4-dioxocyclobuten-1-yl)amino]phenyl]-N-(4-methoxyphenyl)-2-phenylpropanamide |
|---|---|
| PubChem CID | 175237547 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 3-[3-[(2-amino-3,4-dioxocyclobuten-1-yl)amino]phenyl]-N-(4-methoxyphenyl)-2-phenylpropanamide |
| SMILES | COc1ccc(NC(=O)C(Cc2cccc(Nc3c(N)c(=O)c3=O)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H23N3O4/c1-33-20-12-10-18(11-13-20)29-26(32)21(17-7-3-2-4-8-17)15-16-6-5-9-19(14-16)28-23-22(27)24(30)25(23)31/h2-14,21,28H,15,27H2,1H3,(H,29,32) |
| InChIKey | PUSRDDBCBYQDGT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|