C24H27N3O2 — CID 142270741
4-amino-N-[4-amino-3-[(4-methoxyphenyl)methyl]phenyl]-2-phenylbutanamide (PubChem CID 142270741) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 4-amino-N-[4-amino-3-[(4-methoxyphenyl)methyl]phenyl]-2-phenylbutanamide.
| Compound Name | 4-amino-N-[4-amino-3-[(4-methoxyphenyl)methyl]phenyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 142270741 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 4-amino-N-[4-amino-3-[(4-methoxyphenyl)methyl]phenyl]-2-phenylbutanamide |
| SMILES | COc1ccc(Cc2cc(NC(=O)C(CCN)c3ccccc3)ccc2N)cc1 |
| InChI | InChI=1S/C24H27N3O2/c1-29-21-10-7-17(8-11-21)15-19-16-20(9-12-23(19)26)27-24(28)22(13-14-25)18-5-3-2-4-6-18/h2-12,16,22H,13-15,25-26H2,1H3,(H,27,28) |
| InChIKey | KIRADWUXQMFQGK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|