C25H28N6O3 — CID 142270647
3-[[amino-[2-amino-5-[[4-amino-2-(3-methoxyphenyl)butanoyl]amino]phenyl]methylidene]amino]benzamide (PubChem CID 142270647) has the molecular formula C25H28N6O3 and a molecular weight of 460.54 g/mol. Its IUPAC name is 3-[[amino-[2-amino-5-[[4-amino-2-(3-methoxyphenyl)butanoyl]amino]phenyl]methylidene]amino]benzamide.
| Compound Name | 3-[[amino-[2-amino-5-[[4-amino-2-(3-methoxyphenyl)butanoyl]amino]phenyl]methylidene]amino]benzamide |
|---|---|
| PubChem CID | 142270647 |
| Molecular Formula | C25H28N6O3 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 3-[[amino-[2-amino-5-[[4-amino-2-(3-methoxyphenyl)butanoyl]amino]phenyl]methylidene]amino]benzamide |
| SMILES | COc1cccc(C(CCN)C(=O)Nc2ccc(N)c(/C(N)=N/c3cccc(C(N)=O)c3)c2)c1 |
| InChI | InChI=1S/C25H28N6O3/c1-34-19-7-3-4-15(13-19)20(10-11-26)25(33)31-18-8-9-22(27)21(14-18)23(28)30-17-6-2-5-16(12-17)24(29)32/h2-9,12-14,20H,10-11,26-27H2,1H3,(H2,28,30)(H2,29,32)(H,31,33) |
| InChIKey | NSTNBHXQZYERDD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 171.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|