C24H25Cl2N5O — CID 142270772
4-amino-N-[4-amino-3-(N'-benzylcarbamimidoyl)phenyl]-2-(3,4-dichlorophenyl)butanamide (PubChem CID 142270772) has the molecular formula C24H25Cl2N5O and a molecular weight of 470.40 g/mol. Its IUPAC name is 4-amino-N-[4-amino-3-(N'-benzylcarbamimidoyl)phenyl]-2-(3,4-dichlorophenyl)butanamide.
| Compound Name | 4-amino-N-[4-amino-3-(N'-benzylcarbamimidoyl)phenyl]-2-(3,4-dichlorophenyl)butanamide |
|---|---|
| PubChem CID | 142270772 |
| Molecular Formula | C24H25Cl2N5O |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 4-amino-N-[4-amino-3-(N'-benzylcarbamimidoyl)phenyl]-2-(3,4-dichlorophenyl)butanamide |
| SMILES | NCCC(C(=O)Nc1ccc(N)c(/C(N)=N/Cc2ccccc2)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H25Cl2N5O/c25-20-8-6-16(12-21(20)26)18(10-11-27)24(32)31-17-7-9-22(28)19(13-17)23(29)30-14-15-4-2-1-3-5-15/h1-9,12-13,18H,10-11,14,27-28H2,(H2,29,30)(H,31,32) |
| InChIKey | ZRJNXIYFWSGVDL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|