C26H24Cl2N2O — CID 88964807
3-amino-2-(3,4-dichlorophenyl)-N-[4-methyl-3-[(1Z)-1-phenylbuta-1,3-dienyl]phenyl]propanamide (PubChem CID 88964807) has the molecular formula C26H24Cl2N2O and a molecular weight of 451.40 g/mol. Its IUPAC name is 3-amino-2-(3,4-dichlorophenyl)-N-[4-methyl-3-[(1Z)-1-phenylbuta-1,3-dienyl]phenyl]propanamide.
| Compound Name | 3-amino-2-(3,4-dichlorophenyl)-N-[4-methyl-3-[(1Z)-1-phenylbuta-1,3-dienyl]phenyl]propanamide |
|---|---|
| PubChem CID | 88964807 |
| Molecular Formula | C26H24Cl2N2O |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 3-amino-2-(3,4-dichlorophenyl)-N-[4-methyl-3-[(1Z)-1-phenylbuta-1,3-dienyl]phenyl]propanamide |
| SMILES | C=C/C=C(/c1ccccc1)c1cc(NC(=O)C(CN)c2ccc(Cl)c(Cl)c2)ccc1C |
| InChI | InChI=1S/C26H24Cl2N2O/c1-3-7-21(18-8-5-4-6-9-18)22-15-20(12-10-17(22)2)30-26(31)23(16-29)19-11-13-24(27)25(28)14-19/h3-15,23H,1,16,29H2,2H3,(H,30,31)/b21-7- |
| InChIKey | QCPXPHNBIHQGJY-YXSASFKJSA-N |
| XLogP | 6.60 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|