C25H22Cl2F3N5O2 — CID 171926033
N-[2-amino-5-[[4-amino-2-(3,4-dichlorophenyl)butanoyl]amino]benzenecarboximidoyl]-3-(trifluoromethyl)benzamide (PubChem CID 171926033) has the molecular formula C25H22Cl2F3N5O2 and a molecular weight of 552.38 g/mol. Its IUPAC name is N-[2-amino-5-[[4-amino-2-(3,4-dichlorophenyl)butanoyl]amino]benzenecarboximidoyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-amino-5-[[4-amino-2-(3,4-dichlorophenyl)butanoyl]amino]benzenecarboximidoyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 171926033 |
| Molecular Formula | C25H22Cl2F3N5O2 |
| Molecular Weight | 552.38 g/mol |
| Exact Mass | 551.11 |
| IUPAC Name | N-[2-amino-5-[[4-amino-2-(3,4-dichlorophenyl)butanoyl]amino]benzenecarboximidoyl]-3-(trifluoromethyl)benzamide |
| SMILES | [H]/N=C(\NC(=O)c1cccc(C(F)(F)F)c1)c1cc(NC(=O)C(CCN)c2ccc(Cl)c(Cl)c2)ccc1N |
| InChI | InChI=1S/C25H22Cl2F3N5O2/c26-19-6-4-13(11-20(19)27)17(8-9-31)24(37)34-16-5-7-21(32)18(12-16)22(33)35-23(36)14-2-1-3-15(10-14)25(28,29)30/h1-7,10-12,17H,8-9,31-32H2,(H,34,37)(H2,33,35,36) |
| InChIKey | WPJZNSSSRTXIRJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 134.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.38 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|