C23H21Cl3N4O — CID 88964448
4-amino-N-[4-amino-3-(2-chlorophenyl)-5-methanimidoylphenyl]-2-(3,4-dichlorophenyl)butanamide (PubChem CID 88964448) has the molecular formula C23H21Cl3N4O and a molecular weight of 475.81 g/mol. Its IUPAC name is 4-amino-N-[4-amino-3-(2-chlorophenyl)-5-methanimidoylphenyl]-2-(3,4-dichlorophenyl)butanamide.
| Compound Name | 4-amino-N-[4-amino-3-(2-chlorophenyl)-5-methanimidoylphenyl]-2-(3,4-dichlorophenyl)butanamide |
|---|---|
| PubChem CID | 88964448 |
| Molecular Formula | C23H21Cl3N4O |
| Molecular Weight | 475.81 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | 4-amino-N-[4-amino-3-(2-chlorophenyl)-5-methanimidoylphenyl]-2-(3,4-dichlorophenyl)butanamide |
| SMILES | [H]/N=C/c1cc(NC(=O)C(CCN)c2ccc(Cl)c(Cl)c2)cc(-c2ccccc2Cl)c1N |
| InChI | InChI=1S/C23H21Cl3N4O/c24-19-4-2-1-3-17(19)18-11-15(9-14(12-28)22(18)29)30-23(31)16(7-8-27)13-5-6-20(25)21(26)10-13/h1-6,9-12,16,28H,7-8,27,29H2,(H,30,31)/b28-12+ |
| InChIKey | DZOOTKRESCUXKU-KVSWJAHQSA-N |
| XLogP | 5.96 |
| TPSA | 104.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.81 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|