C22H29N6O2+ — CID 142270706
(Z)-[amino-[2-amino-5-[(4-amino-2-phenylbutanoyl)amino]phenyl]methylidene]-[(E)-1-hydroxy-2-methanimidoylbut-2-enyl]azanium (PubChem CID 142270706) has the molecular formula C22H29N6O2+ and a molecular weight of 409.51 g/mol. Its IUPAC name is (Z)-[amino-[2-amino-5-[(4-amino-2-phenylbutanoyl)amino]phenyl]methylidene]-[(E)-1-hydroxy-2-methanimidoylbut-2-enyl]azanium.
| Compound Name | (Z)-[amino-[2-amino-5-[(4-amino-2-phenylbutanoyl)amino]phenyl]methylidene]-[(E)-1-hydroxy-2-methanimidoylbut-2-enyl]azanium |
|---|---|
| PubChem CID | 142270706 |
| Molecular Formula | C22H29N6O2+ |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | (Z)-[amino-[2-amino-5-[(4-amino-2-phenylbutanoyl)amino]phenyl]methylidene]-[(E)-1-hydroxy-2-methanimidoylbut-2-enyl]azanium |
| SMILES | [H]/N=C/C(=C\C)C(O)/[NH+]=C(\N)c1cc(NC(=O)C(CCN)c2ccccc2)ccc1N |
| InChI | InChI=1S/C22H28N6O2/c1-2-14(13-24)21(29)28-20(26)18-12-16(8-9-19(18)25)27-22(30)17(10-11-23)15-6-4-3-5-7-15/h2-9,12-13,17,21,24,29H,10-11,23,25H2,1H3,(H2,26,28)(H,27,30)/p+1/b14-2+,24-13+ |
| InChIKey | KZRZDLPFOSCVFI-VLUJNRADSA-O |
| XLogP | 0.04 |
| TPSA | 165.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|