C19H23Cl2FN4O — CID 142270726
4-amino-N-(4-amino-3-ethanimidoylphenyl)-2-(3,4-dichloro-2-fluoro-4-methylcyclohexa-1,5-dien-1-yl)butanamide (PubChem CID 142270726) has the molecular formula C19H23Cl2FN4O and a molecular weight of 413.32 g/mol. Its IUPAC name is 4-amino-N-(4-amino-3-ethanimidoylphenyl)-2-(3,4-dichloro-2-fluoro-4-methylcyclohexa-1,5-dien-1-yl)butanamide.
| Compound Name | 4-amino-N-(4-amino-3-ethanimidoylphenyl)-2-(3,4-dichloro-2-fluoro-4-methylcyclohexa-1,5-dien-1-yl)butanamide |
|---|---|
| PubChem CID | 142270726 |
| Molecular Formula | C19H23Cl2FN4O |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 4-amino-N-(4-amino-3-ethanimidoylphenyl)-2-(3,4-dichloro-2-fluoro-4-methylcyclohexa-1,5-dien-1-yl)butanamide |
| SMILES | [H]/N=C(\C)c1cc(NC(=O)C(CCN)C2=C(F)C(Cl)C(C)(Cl)C=C2)ccc1N |
| InChI | InChI=1S/C19H23Cl2FN4O/c1-10(24)14-9-11(3-4-15(14)25)26-18(27)13(6-8-23)12-5-7-19(2,21)17(20)16(12)22/h3-5,7,9,13,17,24H,6,8,23,25H2,1-2H3,(H,26,27)/b24-10+ |
| InChIKey | QIHUOHGSJXTESR-YSURURNPSA-N |
| XLogP | 3.96 |
| TPSA | 104.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|