C18H22N4OS — CID 142270818
4-amino-N-(4-amino-3-methanimidoylphenyl)-2-benzylsulfanylbutanamide (PubChem CID 142270818) has the molecular formula C18H22N4OS and a molecular weight of 342.47 g/mol. Its IUPAC name is 4-amino-N-(4-amino-3-methanimidoylphenyl)-2-benzylsulfanylbutanamide.
| Compound Name | 4-amino-N-(4-amino-3-methanimidoylphenyl)-2-benzylsulfanylbutanamide |
|---|---|
| PubChem CID | 142270818 |
| Molecular Formula | C18H22N4OS |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 4-amino-N-(4-amino-3-methanimidoylphenyl)-2-benzylsulfanylbutanamide |
| SMILES | [H]/N=C/c1cc(NC(=O)C(CCN)SCc2ccccc2)ccc1N |
| InChI | InChI=1S/C18H22N4OS/c19-9-8-17(24-12-13-4-2-1-3-5-13)18(23)22-15-6-7-16(21)14(10-15)11-20/h1-7,10-11,17,20H,8-9,12,19,21H2,(H,22,23)/b20-11+ |
| InChIKey | VTWJMKLBHBDADD-RGVLZGJSSA-N |
| XLogP | 2.86 |
| TPSA | 104.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|