C18H19ClN4OS — CID 10150412
4-amino-2-benzylsulfanyl-N-(7-chloro-1H-indazol-5-yl)butanamide (PubChem CID 10150412) has the molecular formula C18H19ClN4OS and a molecular weight of 374.90 g/mol. Its IUPAC name is 4-amino-2-benzylsulfanyl-N-(7-chloro-1H-indazol-5-yl)butanamide.
| Compound Name | 4-amino-2-benzylsulfanyl-N-(7-chloro-1H-indazol-5-yl)butanamide |
|---|---|
| PubChem CID | 10150412 |
| Molecular Formula | C18H19ClN4OS |
| Molecular Weight | 374.90 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 4-amino-2-benzylsulfanyl-N-(7-chloro-1H-indazol-5-yl)butanamide |
| SMILES | NCCC(SCc1ccccc1)C(=O)Nc1cc(Cl)c2[nH]ncc2c1 |
| InChI | InChI=1S/C18H19ClN4OS/c19-15-9-14(8-13-10-21-23-17(13)15)22-18(24)16(6-7-20)25-11-12-4-2-1-3-5-12/h1-5,8-10,16H,6-7,11,20H2,(H,21,23)(H,22,24) |
| InChIKey | CPLUXVDPSAMREH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.90 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |