C14H19N5O3 — CID 90892202
[(2S)-6-amino-1-(1H-indazol-5-ylamino)-1-oxohexan-2-yl]carbamic acid (PubChem CID 90892202) has the molecular formula C14H19N5O3 and a molecular weight of 305.34 g/mol. Its IUPAC name is [(2S)-6-amino-1-(1H-indazol-5-ylamino)-1-oxohexan-2-yl]carbamic acid.
| Compound Name | [(2S)-6-amino-1-(1H-indazol-5-ylamino)-1-oxohexan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 90892202 |
| Molecular Formula | C14H19N5O3 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | [(2S)-6-amino-1-(1H-indazol-5-ylamino)-1-oxohexan-2-yl]carbamic acid |
| SMILES | NCCCC[C@H](NC(=O)O)C(=O)Nc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C14H19N5O3/c15-6-2-1-3-12(18-14(21)22)13(20)17-10-4-5-11-9(7-10)8-16-19-11/h4-5,7-8,12,18H,1-3,6,15H2,(H,16,19)(H,17,20)(H,21,22)/t12-/m0/s1 |
| InChIKey | DPKXCUAWEIVECO-LBPRGKRZSA-N |
| XLogP | 1.27 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|