C25H26BrCl2N5O2 — CID 142270983
N-[amino-[2-amino-5-[[4-amino-2-(4,5-dichloro-6-methylcyclohexa-2,4-dien-1-yl)butanoyl]amino]phenyl]methylidene]-3-bromobenzamide (PubChem CID 142270983) has the molecular formula C25H26BrCl2N5O2 and a molecular weight of 579.33 g/mol. Its IUPAC name is N-[amino-[2-amino-5-[[4-amino-2-(4,5-dichloro-6-methylcyclohexa-2,4-dien-1-yl)butanoyl]amino]phenyl]methylidene]-3-bromobenzamide.
| Compound Name | N-[amino-[2-amino-5-[[4-amino-2-(4,5-dichloro-6-methylcyclohexa-2,4-dien-1-yl)butanoyl]amino]phenyl]methylidene]-3-bromobenzamide |
|---|---|
| PubChem CID | 142270983 |
| Molecular Formula | C25H26BrCl2N5O2 |
| Molecular Weight | 579.33 g/mol |
| Exact Mass | 577.06 |
| IUPAC Name | N-[amino-[2-amino-5-[[4-amino-2-(4,5-dichloro-6-methylcyclohexa-2,4-dien-1-yl)butanoyl]amino]phenyl]methylidene]-3-bromobenzamide |
| SMILES | CC1C(Cl)=C(Cl)C=CC1C(CCN)C(=O)Nc1ccc(N)c(/C(N)=N/C(=O)c2cccc(Br)c2)c1 |
| InChI | InChI=1S/C25H26BrCl2N5O2/c1-13-17(6-7-20(27)22(13)28)18(9-10-29)25(35)32-16-5-8-21(30)19(12-16)23(31)33-24(34)14-3-2-4-15(26)11-14/h2-8,11-13,17-18H,9-10,29-30H2,1H3,(H,32,35)(H2,31,33,34) |
| InChIKey | LLBINBPHANMEFQ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.33 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|