C29H34Cl2N4O3 — CID 142270696
N-[amino-[5-[[4-amino-2-(3,4-dichloro-5-methylcyclohexa-1,3-dien-1-yl)butanoyl]amino]-2-propylphenyl]methylidene]-4-methoxybenzamide (PubChem CID 142270696) has the molecular formula C29H34Cl2N4O3 and a molecular weight of 557.52 g/mol. Its IUPAC name is N-[amino-[5-[[4-amino-2-(3,4-dichloro-5-methylcyclohexa-1,3-dien-1-yl)butanoyl]amino]-2-propylphenyl]methylidene]-4-methoxybenzamide.
| Compound Name | N-[amino-[5-[[4-amino-2-(3,4-dichloro-5-methylcyclohexa-1,3-dien-1-yl)butanoyl]amino]-2-propylphenyl]methylidene]-4-methoxybenzamide |
|---|---|
| PubChem CID | 142270696 |
| Molecular Formula | C29H34Cl2N4O3 |
| Molecular Weight | 557.52 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | N-[amino-[5-[[4-amino-2-(3,4-dichloro-5-methylcyclohexa-1,3-dien-1-yl)butanoyl]amino]-2-propylphenyl]methylidene]-4-methoxybenzamide |
| SMILES | CCCc1ccc(NC(=O)C(CCN)C2=CC(Cl)=C(Cl)C(C)C2)cc1/C(N)=N/C(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C29H34Cl2N4O3/c1-4-5-18-6-9-21(16-24(18)27(33)35-28(36)19-7-10-22(38-3)11-8-19)34-29(37)23(12-13-32)20-14-17(2)26(31)25(30)15-20/h6-11,15-17,23H,4-5,12-14,32H2,1-3H3,(H,34,37)(H2,33,35,36) |
| InChIKey | DAPTYDWKTLLHOS-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.52 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|