C20H24Cl2N4O2 — CID 88964506
4-amino-N-[4-amino-3-(C,N-dimethylcarbonimidoyl)phenyl]-2-(3,4-dichloro-2-methoxyphenyl)butanamide (PubChem CID 88964506) has the molecular formula C20H24Cl2N4O2 and a molecular weight of 423.34 g/mol. Its IUPAC name is 4-amino-N-[4-amino-3-(C,N-dimethylcarbonimidoyl)phenyl]-2-(3,4-dichloro-2-methoxyphenyl)butanamide.
| Compound Name | 4-amino-N-[4-amino-3-(C,N-dimethylcarbonimidoyl)phenyl]-2-(3,4-dichloro-2-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 88964506 |
| Molecular Formula | C20H24Cl2N4O2 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 4-amino-N-[4-amino-3-(C,N-dimethylcarbonimidoyl)phenyl]-2-(3,4-dichloro-2-methoxyphenyl)butanamide |
| SMILES | C/N=C(\C)c1cc(NC(=O)C(CCN)c2ccc(Cl)c(Cl)c2OC)ccc1N |
| InChI | InChI=1S/C20H24Cl2N4O2/c1-11(25-2)15-10-12(4-7-17(15)24)26-20(27)14(8-9-23)13-5-6-16(21)18(22)19(13)28-3/h4-7,10,14H,8-9,23-24H2,1-3H3,(H,26,27)/b25-11+ |
| InChIKey | RAVCILLUWGGJDM-OPEKNORGSA-N |
| XLogP | 4.09 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|