C23H24Cl3N5O — CID 142270984
4-amino-N-[4-amino-3-[amino-(3-chloroanilino)methyl]phenyl]-2-(3,4-dichlorophenyl)butanamide (PubChem CID 142270984) has the molecular formula C23H24Cl3N5O and a molecular weight of 492.84 g/mol. Its IUPAC name is 4-amino-N-[4-amino-3-[amino-(3-chloroanilino)methyl]phenyl]-2-(3,4-dichlorophenyl)butanamide.
| Compound Name | 4-amino-N-[4-amino-3-[amino-(3-chloroanilino)methyl]phenyl]-2-(3,4-dichlorophenyl)butanamide |
|---|---|
| PubChem CID | 142270984 |
| Molecular Formula | C23H24Cl3N5O |
| Molecular Weight | 492.84 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 4-amino-N-[4-amino-3-[amino-(3-chloroanilino)methyl]phenyl]-2-(3,4-dichlorophenyl)butanamide |
| SMILES | NCCC(C(=O)Nc1ccc(N)c(C(N)Nc2cccc(Cl)c2)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H24Cl3N5O/c24-14-2-1-3-15(11-14)30-22(29)18-12-16(5-7-21(18)28)31-23(32)17(8-9-27)13-4-6-19(25)20(26)10-13/h1-7,10-12,17,22,30H,8-9,27-29H2,(H,31,32) |
| InChIKey | MKPZTASWYJFZFX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 119.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.84 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|