C22H22ClF2N5O2S — CID 142270732
N-[amino-[2-amino-5-[[4-amino-2-(3-chloro-2,6-difluorophenyl)butanoyl]amino]phenyl]methyl]thiophene-2-carboxamide (PubChem CID 142270732) has the molecular formula C22H22ClF2N5O2S and a molecular weight of 493.97 g/mol. Its IUPAC name is N-[amino-[2-amino-5-[[4-amino-2-(3-chloro-2,6-difluorophenyl)butanoyl]amino]phenyl]methyl]thiophene-2-carboxamide.
| Compound Name | N-[amino-[2-amino-5-[[4-amino-2-(3-chloro-2,6-difluorophenyl)butanoyl]amino]phenyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 142270732 |
| Molecular Formula | C22H22ClF2N5O2S |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | N-[amino-[2-amino-5-[[4-amino-2-(3-chloro-2,6-difluorophenyl)butanoyl]amino]phenyl]methyl]thiophene-2-carboxamide |
| SMILES | NCCC(C(=O)Nc1ccc(N)c(C(N)NC(=O)c2cccs2)c1)c1c(F)ccc(Cl)c1F |
| InChI | InChI=1S/C22H22ClF2N5O2S/c23-14-4-5-15(24)18(19(14)25)12(7-8-26)21(31)29-11-3-6-16(27)13(10-11)20(28)30-22(32)17-2-1-9-33-17/h1-6,9-10,12,20H,7-8,26-28H2,(H,29,31)(H,30,32) |
| InChIKey | SPBGVHKWOCLIRV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 136.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|