C16H17ClN2O2S — CID 2934696
N-[1-(4-chloroanilino)-3-methyl-1-oxobutan-2-yl]thiophene-2-carboxamide (PubChem CID 2934696) has the molecular formula C16H17ClN2O2S and a molecular weight of 336.84 g/mol. Its IUPAC name is N-[1-(4-chloroanilino)-3-methyl-1-oxobutan-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-(4-chloroanilino)-3-methyl-1-oxobutan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 2934696 |
| Molecular Formula | C16H17ClN2O2S |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | N-[1-(4-chloroanilino)-3-methyl-1-oxobutan-2-yl]thiophene-2-carboxamide |
| SMILES | CC(C)C(NC(=O)c1cccs1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17ClN2O2S/c1-10(2)14(19-15(20)13-4-3-9-22-13)16(21)18-12-7-5-11(17)6-8-12/h3-10,14H,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | DKRGKTSRKXMGQQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |