C20H17ClN2O2S2 — CID 22776740
N-[4-[1-(4-chloroanilino)-1-oxopropan-2-yl]sulfanylphenyl]thiophene-2-carboxamide (PubChem CID 22776740) has the molecular formula C20H17ClN2O2S2 and a molecular weight of 416.96 g/mol. Its IUPAC name is N-[4-[1-(4-chloroanilino)-1-oxopropan-2-yl]sulfanylphenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[1-(4-chloroanilino)-1-oxopropan-2-yl]sulfanylphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 22776740 |
| Molecular Formula | C20H17ClN2O2S2 |
| Molecular Weight | 416.96 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | N-[4-[1-(4-chloroanilino)-1-oxopropan-2-yl]sulfanylphenyl]thiophene-2-carboxamide |
| SMILES | CC(Sc1ccc(NC(=O)c2cccs2)cc1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H17ClN2O2S2/c1-13(19(24)22-15-6-4-14(21)5-7-15)27-17-10-8-16(9-11-17)23-20(25)18-3-2-12-26-18/h2-13H,1H3,(H,22,24)(H,23,25) |
| InChIKey | CZYIOEFKPYUVST-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.96 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |