C22H18ClF2N5O — CID 142270881
N-[4-amino-3-[amino-(3-cyanoanilino)methyl]phenyl]-2-(3-chloro-2,6-difluorophenyl)acetamide (PubChem CID 142270881) has the molecular formula C22H18ClF2N5O and a molecular weight of 441.87 g/mol. Its IUPAC name is N-[4-amino-3-[amino-(3-cyanoanilino)methyl]phenyl]-2-(3-chloro-2,6-difluorophenyl)acetamide.
| Compound Name | N-[4-amino-3-[amino-(3-cyanoanilino)methyl]phenyl]-2-(3-chloro-2,6-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 142270881 |
| Molecular Formula | C22H18ClF2N5O |
| Molecular Weight | 441.87 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | N-[4-amino-3-[amino-(3-cyanoanilino)methyl]phenyl]-2-(3-chloro-2,6-difluorophenyl)acetamide |
| SMILES | N#Cc1cccc(NC(N)c2cc(NC(=O)Cc3c(F)ccc(Cl)c3F)ccc2N)c1 |
| InChI | InChI=1S/C22H18ClF2N5O/c23-17-5-6-18(24)15(21(17)25)10-20(31)29-14-4-7-19(27)16(9-14)22(28)30-13-3-1-2-12(8-13)11-26/h1-9,22,30H,10,27-28H2,(H,29,31) |
| InChIKey | XKZNLQHOIJPDKC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 116.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.87 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|