C25H21Cl2N5O2 — CID 173474805
N-[5-[[4-amino-2-(3,4-dichlorophenyl)butanoyl]amino]-2-ethynylbenzenecarboximidoyl]pyridine-3-carboxamide (PubChem CID 173474805) has the molecular formula C25H21Cl2N5O2 and a molecular weight of 494.38 g/mol. Its IUPAC name is N-[5-[[4-amino-2-(3,4-dichlorophenyl)butanoyl]amino]-2-ethynylbenzenecarboximidoyl]pyridine-3-carboxamide.
| Compound Name | N-[5-[[4-amino-2-(3,4-dichlorophenyl)butanoyl]amino]-2-ethynylbenzenecarboximidoyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 173474805 |
| Molecular Formula | C25H21Cl2N5O2 |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | N-[5-[[4-amino-2-(3,4-dichlorophenyl)butanoyl]amino]-2-ethynylbenzenecarboximidoyl]pyridine-3-carboxamide |
| SMILES | [H]/N=C(\NC(=O)c1cccnc1)c1cc(NC(=O)C(CCN)c2ccc(Cl)c(Cl)c2)ccc1C#C |
| InChI | InChI=1S/C25H21Cl2N5O2/c1-2-15-5-7-18(13-20(15)23(29)32-24(33)17-4-3-11-30-14-17)31-25(34)19(9-10-28)16-6-8-21(26)22(27)12-16/h1,3-8,11-14,19H,9-10,28H2,(H,31,34)(H2,29,32,33) |
| InChIKey | IDLDGXFJQBQFAK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|