C14H13ClN4O2 — CID 39184826
N-[5-[(2-aminoacetyl)amino]-2-chlorophenyl]pyridine-3-carboxamide (PubChem CID 39184826) has the molecular formula C14H13ClN4O2 and a molecular weight of 304.74 g/mol. Its IUPAC name is N-[5-[(2-aminoacetyl)amino]-2-chlorophenyl]pyridine-3-carboxamide.
| Compound Name | N-[5-[(2-aminoacetyl)amino]-2-chlorophenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 39184826 |
| Molecular Formula | C14H13ClN4O2 |
| Molecular Weight | 304.74 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | N-[5-[(2-aminoacetyl)amino]-2-chlorophenyl]pyridine-3-carboxamide |
| SMILES | NCC(=O)Nc1ccc(Cl)c(NC(=O)c2cccnc2)c1 |
| InChI | InChI=1S/C14H13ClN4O2/c15-11-4-3-10(18-13(20)7-16)6-12(11)19-14(21)9-2-1-5-17-8-9/h1-6,8H,7,16H2,(H,18,20)(H,19,21) |
| InChIKey | MCRCKPKWDVWADB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.74 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |