C16H16ClN3O3 — CID 39184782
N-[5-[(2-aminoacetyl)amino]-2-chlorophenyl]-3-methoxybenzamide (PubChem CID 39184782) has the molecular formula C16H16ClN3O3 and a molecular weight of 333.78 g/mol. Its IUPAC name is N-[5-[(2-aminoacetyl)amino]-2-chlorophenyl]-3-methoxybenzamide.
| Compound Name | N-[5-[(2-aminoacetyl)amino]-2-chlorophenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 39184782 |
| Molecular Formula | C16H16ClN3O3 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N-[5-[(2-aminoacetyl)amino]-2-chlorophenyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2cc(NC(=O)CN)ccc2Cl)c1 |
| InChI | InChI=1S/C16H16ClN3O3/c1-23-12-4-2-3-10(7-12)16(22)20-14-8-11(5-6-13(14)17)19-15(21)9-18/h2-8H,9,18H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | YCQBVVQMYWNMTO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |