C13H18N2 — CID 175237966
1,4-diethylbenzene;1H-imidazole (PubChem CID 175237966) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 1,4-diethylbenzene;1H-imidazole.
| Compound Name | 1,4-diethylbenzene;1H-imidazole |
|---|---|
| PubChem CID | 175237966 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1,4-diethylbenzene;1H-imidazole |
| SMILES | CCc1ccc(CC)cc1.c1c[nH]cn1 |
| InChI | InChI=1S/C10H14.C3H4N2/c1-3-9-5-7-10(4-2)8-6-9;1-2-5-3-4-1/h5-8H,3-4H2,1-2H3;1-3H,(H,4,5) |
| InChIKey | CKZQNWRZBJFCJK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |