C19H24N2O — CID 175239812
2,4-bis(3-amino-2-methylphenyl)pentan-3-one (PubChem CID 175239812) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 2,4-bis(3-amino-2-methylphenyl)pentan-3-one.
| Compound Name | 2,4-bis(3-amino-2-methylphenyl)pentan-3-one |
|---|---|
| PubChem CID | 175239812 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 2,4-bis(3-amino-2-methylphenyl)pentan-3-one |
| SMILES | Cc1c(N)cccc1C(C)C(=O)C(C)c1cccc(N)c1C |
| InChI | InChI=1S/C19H24N2O/c1-11-15(7-5-9-17(11)20)13(3)19(22)14(4)16-8-6-10-18(21)12(16)2/h5-10,13-14H,20-21H2,1-4H3 |
| InChIKey | OTRTXGJKTCRKPN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|