C24H32F3N3OS — CID 175245385
N-[[2-(2-methoxyphenyl)sulfanylphenyl]methyl]-N-methyl-4-[4-(trifluoromethyl)piperazin-1-yl]butan-1-amine (PubChem CID 175245385) has the molecular formula C24H32F3N3OS and a molecular weight of 467.60 g/mol. Its IUPAC name is N-[[2-(2-methoxyphenyl)sulfanylphenyl]methyl]-N-methyl-4-[4-(trifluoromethyl)piperazin-1-yl]butan-1-amine.
| Compound Name | N-[[2-(2-methoxyphenyl)sulfanylphenyl]methyl]-N-methyl-4-[4-(trifluoromethyl)piperazin-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 175245385 |
| Molecular Formula | C24H32F3N3OS |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | N-[[2-(2-methoxyphenyl)sulfanylphenyl]methyl]-N-methyl-4-[4-(trifluoromethyl)piperazin-1-yl]butan-1-amine |
| SMILES | COc1ccccc1Sc1ccccc1CN(C)CCCCN1CCN(C(F)(F)F)CC1 |
| InChI | InChI=1S/C24H32F3N3OS/c1-28(13-7-8-14-29-15-17-30(18-16-29)24(25,26)27)19-20-9-3-5-11-22(20)32-23-12-6-4-10-21(23)31-2/h3-6,9-12H,7-8,13-19H2,1-2H3 |
| InChIKey | NLQIMANWYDMIKX-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|