C21H19ClN4O3 — CID 175245681
2-[2-(chloromethyl)-7-phenylmethoxyimidazo[4,5-c]quinolin-1-yl]ethyl carbamate (PubChem CID 175245681) has the molecular formula C21H19ClN4O3 and a molecular weight of 410.86 g/mol. Its IUPAC name is 2-[2-(chloromethyl)-7-phenylmethoxyimidazo[4,5-c]quinolin-1-yl]ethyl carbamate.
| Compound Name | 2-[2-(chloromethyl)-7-phenylmethoxyimidazo[4,5-c]quinolin-1-yl]ethyl carbamate |
|---|---|
| PubChem CID | 175245681 |
| Molecular Formula | C21H19ClN4O3 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 2-[2-(chloromethyl)-7-phenylmethoxyimidazo[4,5-c]quinolin-1-yl]ethyl carbamate |
| SMILES | NC(=O)OCCn1c(CCl)nc2cnc3cc(OCc4ccccc4)ccc3c21 |
| InChI | InChI=1S/C21H19ClN4O3/c22-11-19-25-18-12-24-17-10-15(29-13-14-4-2-1-3-5-14)6-7-16(17)20(18)26(19)8-9-28-21(23)27/h1-7,10,12H,8-9,11,13H2,(H2,23,27) |
| InChIKey | VKIUDTZHGRHQOE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|